About ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine
ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine (PubChem CID 157035998) has the molecular formula C24H35N3
and a molecular weight of 365.57 g/mol. Its IUPAC name is ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine |
| PubChem CID | 157035998 |
| Molecular Formula | C24H35N3 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine |
| SMILES | CC.CC.Cn1cnc(-c2ccccc2)c1.c1ccc(C2CCNC2)cc1 |
| InChI | InChI=1S/C10H10N2.C10H13N.2C2H6/c1-12-7-10(11-8-12)9-5-3-2-4-6-9;1-2-4-9(5-3-1)10-6-7-11-8-10;2*1-2/h2-8H,1H3;1-5,10-11H,6-8H2;2*1-2H3 |
| InChIKey | NJVSBMATYYOTOI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine?
The IUPAC name of ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine (CID 157035998) is ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine.
What is the SMILES notation for ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine?
The canonical SMILES for ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine is CC.CC.Cn1cnc(-c2ccccc2)c1.c1ccc(C2CCNC2)cc1.
What is the InChIKey of ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine?
The InChIKey is NJVSBMATYYOTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C10H13N.2C2H6/c1-12-7-10(11-8-12)9-5-3-2-4-6-9;1-2-4-9(5-3-1)10-6-7-11-8-10;2*1-2/h2-8H,1H3;1-5,10-11H,6-8H2;2*1-2H3.
What are the key properties of ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine?
ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine has a molecular weight of 365.57 g/mol, XLogP of 5.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-phenylimidazole;3-phenylpyrrolidine is sourced from PubChem (CID 157035998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).