C25H26ClN3 — CID 162332780
3-ethyl-1-phenyl-6-(4-pyrrolidin-3-ylphenyl)indazole;hydrochloride (PubChem CID 162332780) has the molecular formula C25H26ClN3 and a molecular weight of 403.96 g/mol. Its IUPAC name is 3-ethyl-1-phenyl-6-(4-pyrrolidin-3-ylphenyl)indazole;hydrochloride.
| Compound Name | 3-ethyl-1-phenyl-6-(4-pyrrolidin-3-ylphenyl)indazole;hydrochloride |
|---|---|
| PubChem CID | 162332780 |
| Molecular Formula | C25H26ClN3 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-ethyl-1-phenyl-6-(4-pyrrolidin-3-ylphenyl)indazole;hydrochloride |
| SMILES | CCc1nn(-c2ccccc2)c2cc(-c3ccc(C4CCNC4)cc3)ccc12.Cl |
| InChI | InChI=1S/C25H25N3.ClH/c1-2-24-23-13-12-20(16-25(23)28(27-24)22-6-4-3-5-7-22)18-8-10-19(11-9-18)21-14-15-26-17-21;/h3-13,16,21,26H,2,14-15,17H2,1H3;1H |
| InChIKey | FPWKHHMXYFYYEZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |