C23H29N5 — CID 58483601
3-ethyl-1-phenyl-6-(3-piperazin-1-ylpyrrolidin-1-yl)indazole (PubChem CID 58483601) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-ethyl-1-phenyl-6-(3-piperazin-1-ylpyrrolidin-1-yl)indazole.
| Compound Name | 3-ethyl-1-phenyl-6-(3-piperazin-1-ylpyrrolidin-1-yl)indazole |
|---|---|
| PubChem CID | 58483601 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 3-ethyl-1-phenyl-6-(3-piperazin-1-ylpyrrolidin-1-yl)indazole |
| SMILES | CCc1nn(-c2ccccc2)c2cc(N3CCC(N4CCNCC4)C3)ccc12 |
| InChI | InChI=1S/C23H29N5/c1-2-22-21-9-8-19(16-23(21)28(25-22)18-6-4-3-5-7-18)27-13-10-20(17-27)26-14-11-24-12-15-26/h3-9,16,20,24H,2,10-15,17H2,1H3 |
| InChIKey | FIAHPLXXCQXTEA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |