C18H25N5 — CID 120967885
1-[1-[(2-phenylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120967885) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[1-[(2-phenylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[(2-phenylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120967885 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-[1-[(2-phenylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperazine |
| SMILES | c1ccc(-n2nccc2CN2CCC(N3CCNCC3)C2)cc1 |
| InChI | InChI=1S/C18H25N5/c1-2-4-16(5-3-1)23-18(6-8-20-23)15-21-11-7-17(14-21)22-12-9-19-10-13-22/h1-6,8,17,19H,7,9-15H2 |
| InChIKey | USZPIROXUMXIIW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |