C19H28ClN5 — CID 120967485
1-[1-[(2-methyl-3-phenylimidazol-4-yl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride (PubChem CID 120967485) has the molecular formula C19H28ClN5 and a molecular weight of 361.92 g/mol. Its IUPAC name is 1-[1-[(2-methyl-3-phenylimidazol-4-yl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride.
| Compound Name | 1-[1-[(2-methyl-3-phenylimidazol-4-yl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120967485 |
| Molecular Formula | C19H28ClN5 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 1-[1-[(2-methyl-3-phenylimidazol-4-yl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
| SMILES | Cc1ncc(CN2CCC(N3CCNCC3)C2)n1-c1ccccc1.Cl |
| InChI | InChI=1S/C19H27N5.ClH/c1-16-21-13-19(24(16)17-5-3-2-4-6-17)15-22-10-7-18(14-22)23-11-8-20-9-12-23;/h2-6,13,18,20H,7-12,14-15H2,1H3;1H |
| InChIKey | XMCVGKPKCQPJAO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |