C14H23ClN4 — CID 120968330
1-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]piperazine;hydrochloride (PubChem CID 120968330) has the molecular formula C14H23ClN4 and a molecular weight of 282.82 g/mol. Its IUPAC name is 1-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]piperazine;hydrochloride.
| Compound Name | 1-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120968330 |
| Molecular Formula | C14H23ClN4 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-[1-(pyridin-4-ylmethyl)pyrrolidin-3-yl]piperazine;hydrochloride |
| SMILES | Cl.c1cc(CN2CCC(N3CCNCC3)C2)ccn1 |
| InChI | InChI=1S/C14H22N4.ClH/c1-4-15-5-2-13(1)11-17-8-3-14(12-17)18-9-6-16-7-10-18;/h1-2,4-5,14,16H,3,6-12H2;1H |
| InChIKey | PSZPDDGQOJBYIB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |