C13H23N5 — CID 120968218
1-[1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120968218) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120968218 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 1-[1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]piperazine |
| SMILES | Cn1ccnc1CN1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C13H23N5/c1-16-7-5-15-13(16)11-17-6-2-12(10-17)18-8-3-14-4-9-18/h5,7,12,14H,2-4,6,8-11H2,1H3 |
| InChIKey | BKZBLGMBLXXRPN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |