C22H30ClN3O2 — CID 120968141
1-[1-[[4-(4-methoxyphenoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride (PubChem CID 120968141) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is 1-[1-[[4-(4-methoxyphenoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride.
| Compound Name | 1-[1-[[4-(4-methoxyphenoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120968141 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[1-[[4-(4-methoxyphenoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
| SMILES | COc1ccc(Oc2ccc(CN3CCC(N4CCNCC4)C3)cc2)cc1.Cl |
| InChI | InChI=1S/C22H29N3O2.ClH/c1-26-20-6-8-22(9-7-20)27-21-4-2-18(3-5-21)16-24-13-10-19(17-24)25-14-11-23-12-15-25;/h2-9,19,23H,10-17H2,1H3;1H |
| InChIKey | VSGYZGGFZGWPIM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |