C19H29N3O2 — CID 120968570
1-[1-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120968570) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[1-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120968570 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[1-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidin-3-yl]piperazine |
| SMILES | C=CCOc1ccc(CN2CCC(N3CCNCC3)C2)cc1OC |
| InChI | InChI=1S/C19H29N3O2/c1-3-12-24-18-5-4-16(13-19(18)23-2)14-21-9-6-17(15-21)22-10-7-20-8-11-22/h3-5,13,17,20H,1,6-12,14-15H2,2H3 |
| InChIKey | IPZBADNDOAUPMK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|