C22H30N4O2 — CID 120968049
1-[1-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120968049) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[1-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120968049 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[1-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]pyrrolidin-3-yl]piperazine |
| SMILES | COc1cc(CN2CCC(N3CCNCC3)C2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C22H30N4O2/c1-27-22-14-19(2-3-21(22)28-17-18-4-7-23-8-5-18)15-25-11-6-20(16-25)26-12-9-24-10-13-26/h2-5,7-8,14,20,24H,6,9-13,15-17H2,1H3 |
| InChIKey | IMKIEAGSNJSJKG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |