C23H35N5 — CID 120968069
1-[1-[(1-benzyl-3-tert-butylpyrazol-4-yl)methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120968069) has the molecular formula C23H35N5 and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-[1-[(1-benzyl-3-tert-butylpyrazol-4-yl)methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[(1-benzyl-3-tert-butylpyrazol-4-yl)methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120968069 |
| Molecular Formula | C23H35N5 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | 1-[1-[(1-benzyl-3-tert-butylpyrazol-4-yl)methyl]pyrrolidin-3-yl]piperazine |
| SMILES | CC(C)(C)c1nn(Cc2ccccc2)cc1CN1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C23H35N5/c1-23(2,3)22-20(17-28(25-22)15-19-7-5-4-6-8-19)16-26-12-9-21(18-26)27-13-10-24-11-14-27/h4-8,17,21,24H,9-16,18H2,1-3H3 |
| InChIKey | IBUQJSRQNFAQNO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |