C20H28ClN5O — CID 120836012
[1-[(2-phenylpyrazol-3-yl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 120836012) has the molecular formula C20H28ClN5O and a molecular weight of 389.93 g/mol. Its IUPAC name is [1-[(2-phenylpyrazol-3-yl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [1-[(2-phenylpyrazol-3-yl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120836012 |
| Molecular Formula | C20H28ClN5O |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [1-[(2-phenylpyrazol-3-yl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCN(Cc2ccnn2-c2ccccc2)C1)N1CCNCC1 |
| InChI | InChI=1S/C20H27N5O.ClH/c26-20(24-13-10-21-11-14-24)17-5-4-12-23(15-17)16-19-8-9-22-25(19)18-6-2-1-3-7-18;/h1-3,6-9,17,21H,4-5,10-16H2;1H |
| InChIKey | YNAGBBNQLMILEQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |