C20H26FN5O — CID 120836185
[1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-3-yl]-piperazin-1-ylmethanone (PubChem CID 120836185) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is [1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-3-yl]-piperazin-1-ylmethanone.
| Compound Name | [1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-3-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 120836185 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-3-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(C1CCCN(Cc2ccnn2-c2ccc(F)cc2)C1)N1CCNCC1 |
| InChI | InChI=1S/C20H26FN5O/c21-17-3-5-18(6-4-17)26-19(7-8-23-26)15-24-11-1-2-16(14-24)20(27)25-12-9-22-10-13-25/h3-8,16,22H,1-2,9-15H2 |
| InChIKey | VSTWZLMQXHNZKC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |