C17H27ClN4O — CID 120836090
[1-[(4-methyl-3-pyridinyl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 120836090) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is [1-[(4-methyl-3-pyridinyl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [1-[(4-methyl-3-pyridinyl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120836090 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [1-[(4-methyl-3-pyridinyl)methyl]piperidin-3-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cc1ccncc1CN1CCCC(C(=O)N2CCNCC2)C1.Cl |
| InChI | InChI=1S/C17H26N4O.ClH/c1-14-4-5-19-11-16(14)13-20-8-2-3-15(12-20)17(22)21-9-6-18-7-10-21;/h4-5,11,15,18H,2-3,6-10,12-13H2,1H3;1H |
| InChIKey | ZWZQBOLGRBNXMY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |