C24H31N5O3S — CID 25130686
3-ethyl-1-[3-[(3S)-3-methoxypyrrolidin-1-yl]phenyl]sulfonyl-6-piperazin-1-ylindazole (PubChem CID 25130686) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-ethyl-1-[3-[(3S)-3-methoxypyrrolidin-1-yl]phenyl]sulfonyl-6-piperazin-1-ylindazole.
| Compound Name | 3-ethyl-1-[3-[(3S)-3-methoxypyrrolidin-1-yl]phenyl]sulfonyl-6-piperazin-1-ylindazole |
|---|---|
| PubChem CID | 25130686 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-ethyl-1-[3-[(3S)-3-methoxypyrrolidin-1-yl]phenyl]sulfonyl-6-piperazin-1-ylindazole |
| SMILES | CCc1nn(S(=O)(=O)c2cccc(N3CC[C@H](OC)C3)c2)c2cc(N3CCNCC3)ccc12 |
| InChI | InChI=1S/C24H31N5O3S/c1-3-23-22-8-7-19(27-13-10-25-11-14-27)16-24(22)29(26-23)33(30,31)21-6-4-5-18(15-21)28-12-9-20(17-28)32-2/h4-8,15-16,20,25H,3,9-14,17H2,1-2H3/t20-/m0/s1 |
| InChIKey | JTTZZROAYPUWGA-FQEVSTJZSA-N |
| XLogP | 2.47 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |