C19H23N5O4S — CID 160703088
3-ethyl-6-piperazin-1-yl-1-pyridin-3-ylsulfonylindazole;formic acid (PubChem CID 160703088) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-ethyl-6-piperazin-1-yl-1-pyridin-3-ylsulfonylindazole;formic acid.
| Compound Name | 3-ethyl-6-piperazin-1-yl-1-pyridin-3-ylsulfonylindazole;formic acid |
|---|---|
| PubChem CID | 160703088 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 3-ethyl-6-piperazin-1-yl-1-pyridin-3-ylsulfonylindazole;formic acid |
| SMILES | CCc1nn(S(=O)(=O)c2cccnc2)c2cc(N3CCNCC3)ccc12.O=CO |
| InChI | InChI=1S/C18H21N5O2S.CH2O2/c1-2-17-16-6-5-14(22-10-8-19-9-11-22)12-18(16)23(21-17)26(24,25)15-4-3-7-20-13-15;2-1-3/h3-7,12-13,19H,2,8-11H2,1H3;1H,(H,2,3) |
| InChIKey | RQWLCBFJTBVPBE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|