C20H24N4O6S — CID 158369892
1-(2,5-dimethoxyphenyl)sulfonyl-6-piperazin-1-ylindazole;formic acid (PubChem CID 158369892) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-6-piperazin-1-ylindazole;formic acid.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-6-piperazin-1-ylindazole;formic acid |
|---|---|
| PubChem CID | 158369892 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-6-piperazin-1-ylindazole;formic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)n2ncc3ccc(N4CCNCC4)cc32)c1.O=CO |
| InChI | InChI=1S/C19H22N4O4S.CH2O2/c1-26-16-5-6-18(27-2)19(12-16)28(24,25)23-17-11-15(4-3-14(17)13-21-23)22-9-7-20-8-10-22;2-1-3/h3-6,11-13,20H,7-10H2,1-2H3;1H,(H,2,3) |
| InChIKey | GUMBVYWXVPAGKX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|