C19H22N4O4S — CID 46203084
1-(2,5-dimethoxyphenyl)sulfonyl-4-piperazin-1-ylbenzimidazole (PubChem CID 46203084) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-4-piperazin-1-ylbenzimidazole.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-piperazin-1-ylbenzimidazole |
|---|---|
| PubChem CID | 46203084 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-4-piperazin-1-ylbenzimidazole |
| SMILES | COc1ccc(OC)c(S(=O)(=O)n2cnc3c(N4CCNCC4)cccc32)c1 |
| InChI | InChI=1S/C19H22N4O4S/c1-26-14-6-7-17(27-2)18(12-14)28(24,25)23-13-21-19-15(4-3-5-16(19)23)22-10-8-20-9-11-22/h3-7,12-13,20H,8-11H2,1-2H3 |
| InChIKey | CIQVAMQHEXBMSE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |