C20H21F2N3O3S — CID 118654355
3-(difluoromethyl)-1-(4-methoxyphenyl)sulfonyl-4-piperazin-1-ylindole (PubChem CID 118654355) has the molecular formula C20H21F2N3O3S and a molecular weight of 421.47 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(4-methoxyphenyl)sulfonyl-4-piperazin-1-ylindole.
| Compound Name | 3-(difluoromethyl)-1-(4-methoxyphenyl)sulfonyl-4-piperazin-1-ylindole |
|---|---|
| PubChem CID | 118654355 |
| Molecular Formula | C20H21F2N3O3S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-(difluoromethyl)-1-(4-methoxyphenyl)sulfonyl-4-piperazin-1-ylindole |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C(F)F)c3c(N4CCNCC4)cccc32)cc1 |
| InChI | InChI=1S/C20H21F2N3O3S/c1-28-14-5-7-15(8-6-14)29(26,27)25-13-16(20(21)22)19-17(3-2-4-18(19)25)24-11-9-23-10-12-24/h2-8,13,20,23H,9-12H2,1H3 |
| InChIKey | AEHXECNKXFLQMZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |