C20H20F3N3O2S — CID 118654357
3-(difluoromethyl)-1-(4-fluorophenyl)sulfonyl-N-piperidin-4-ylindol-4-amine (PubChem CID 118654357) has the molecular formula C20H20F3N3O2S and a molecular weight of 423.46 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(4-fluorophenyl)sulfonyl-N-piperidin-4-ylindol-4-amine.
| Compound Name | 3-(difluoromethyl)-1-(4-fluorophenyl)sulfonyl-N-piperidin-4-ylindol-4-amine |
|---|---|
| PubChem CID | 118654357 |
| Molecular Formula | C20H20F3N3O2S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-(difluoromethyl)-1-(4-fluorophenyl)sulfonyl-N-piperidin-4-ylindol-4-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)n1cc(C(F)F)c2c(NC3CCNCC3)cccc21 |
| InChI | InChI=1S/C20H20F3N3O2S/c21-13-4-6-15(7-5-13)29(27,28)26-12-16(20(22)23)19-17(2-1-3-18(19)26)25-14-8-10-24-11-9-14/h1-7,12,14,20,24-25H,8-11H2 |
| InChIKey | ILIPIPRFVQGUKI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |