C22H26ClF2N3O2S — CID 144993589
1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-(piperazin-1-ylmethyl)indole;ethane (PubChem CID 144993589) has the molecular formula C22H26ClF2N3O2S and a molecular weight of 469.99 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-(piperazin-1-ylmethyl)indole;ethane.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-(piperazin-1-ylmethyl)indole;ethane |
|---|---|
| PubChem CID | 144993589 |
| Molecular Formula | C22H26ClF2N3O2S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-(piperazin-1-ylmethyl)indole;ethane |
| SMILES | CC.O=S(=O)(c1ccccc1Cl)n1cc(C(F)F)c2c(CN3CCNCC3)cccc21 |
| InChI | InChI=1S/C20H20ClF2N3O2S.C2H6/c21-16-5-1-2-7-18(16)29(27,28)26-13-15(20(22)23)19-14(4-3-6-17(19)26)12-25-10-8-24-9-11-25;1-2/h1-7,13,20,24H,8-12H2;1-2H3 |
| InChIKey | TURUAAWYVCJEJG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |