C19H20BrN3O2S — CID 68544798
1-(2-bromophenyl)sulfonyl-4-(piperazin-1-ylmethyl)indole (PubChem CID 68544798) has the molecular formula C19H20BrN3O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-4-(piperazin-1-ylmethyl)indole.
| Compound Name | 1-(2-bromophenyl)sulfonyl-4-(piperazin-1-ylmethyl)indole |
|---|---|
| PubChem CID | 68544798 |
| Molecular Formula | C19H20BrN3O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-4-(piperazin-1-ylmethyl)indole |
| SMILES | O=S(=O)(c1ccccc1Br)n1ccc2c(CN3CCNCC3)cccc21 |
| InChI | InChI=1S/C19H20BrN3O2S/c20-17-5-1-2-7-19(17)26(24,25)23-11-8-16-15(4-3-6-18(16)23)14-22-12-9-21-10-13-22/h1-8,11,21H,9-10,12-14H2 |
| InChIKey | KZPBHYJYXRXJHV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |