C20H24ClN3O2S — CID 175183696
1-(4-methylphenyl)sulfonyl-3-(piperazin-1-ylmethyl)indole;hydrochloride (PubChem CID 175183696) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-(piperazin-1-ylmethyl)indole;hydrochloride.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-(piperazin-1-ylmethyl)indole;hydrochloride |
|---|---|
| PubChem CID | 175183696 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-(piperazin-1-ylmethyl)indole;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CN3CCNCC3)c3ccccc32)cc1.Cl |
| InChI | InChI=1S/C20H23N3O2S.ClH/c1-16-6-8-18(9-7-16)26(24,25)23-15-17(14-22-12-10-21-11-13-22)19-4-2-3-5-20(19)23;/h2-9,15,21H,10-14H2,1H3;1H |
| InChIKey | ATNWHGXAAOQOIA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |