C29H31N3O4S — CID 175364963
benzyl 2-[4-[[1-(4-methylphenyl)sulfonylindol-3-yl]methyl]piperazin-1-yl]acetate (PubChem CID 175364963) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is benzyl 2-[4-[[1-(4-methylphenyl)sulfonylindol-3-yl]methyl]piperazin-1-yl]acetate.
| Compound Name | benzyl 2-[4-[[1-(4-methylphenyl)sulfonylindol-3-yl]methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 175364963 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | benzyl 2-[4-[[1-(4-methylphenyl)sulfonylindol-3-yl]methyl]piperazin-1-yl]acetate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CN3CCN(CC(=O)OCc4ccccc4)CC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H31N3O4S/c1-23-11-13-26(14-12-23)37(34,35)32-20-25(27-9-5-6-10-28(27)32)19-30-15-17-31(18-16-30)21-29(33)36-22-24-7-3-2-4-8-24/h2-14,20H,15-19,21-22H2,1H3 |
| InChIKey | MKCJFRBPCBKNSE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |