C22H27NO4S — CID 166448326
benzyl 3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]propanoate (PubChem CID 166448326) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is benzyl 3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]propanoate.
| Compound Name | benzyl 3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 166448326 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | benzyl 3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(CCC(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-18-7-10-21(11-8-18)28(25,26)23-15-13-19(14-16-23)9-12-22(24)27-17-20-5-3-2-4-6-20/h2-8,10-11,19H,9,12-17H2,1H3 |
| InChIKey | YOIWAANNEKEWGQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |