C24H30NO6S2 — CID 162403759
CID 162403759 (PubChem CID 162403759) has the molecular formula C24H30NO6S2 and a molecular weight of 492.64 g/mol.
| Compound Name | CID 162403759 |
|---|---|
| PubChem CID | 162403759 |
| Molecular Formula | C24H30NO6S2 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | — |
| SMILES | CCOC(=O)[C](CC[C@@H]1CCN(S(=O)(=O)c2ccc(C)cc2)C1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30NO6S2/c1-3-31-24(26)21(18-32(27,28)22-7-5-4-6-8-22)12-11-20-15-16-25(17-20)33(29,30)23-13-9-19(2)10-14-23/h4-10,13-14,20H,3,11-12,15-18H2,1-2H3/t20-/m1/s1 |
| InChIKey | PAQXBMCYVJLXID-HXUWFJFHSA-N |
| XLogP | 3.40 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |