C21H24N2O4S — CID 101007735
(3Z)-1-[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-3-phenylmethoxyiminopropan-2-one (PubChem CID 101007735) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (3Z)-1-[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-3-phenylmethoxyiminopropan-2-one.
| Compound Name | (3Z)-1-[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-3-phenylmethoxyiminopropan-2-one |
|---|---|
| PubChem CID | 101007735 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (3Z)-1-[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-3-phenylmethoxyiminopropan-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(CC(=O)/C=N\OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-17-7-9-21(10-8-17)28(25,26)23-12-11-19(15-23)13-20(24)14-22-27-16-18-5-3-2-4-6-18/h2-10,14,19H,11-13,15-16H2,1H3/b22-14- |
| InChIKey | XPZJKVMJYKECFS-HMAPJEAMSA-N |
| XLogP | 3.17 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|