C25H24N2O4SSe — CID 139089639
methyl N-[(1R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-1-phenylselanylethyl]carbamate (PubChem CID 139089639) has the molecular formula C25H24N2O4SSe and a molecular weight of 527.50 g/mol. Its IUPAC name is methyl N-[(1R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-1-phenylselanylethyl]carbamate.
| Compound Name | methyl N-[(1R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-1-phenylselanylethyl]carbamate |
|---|---|
| PubChem CID | 139089639 |
| Molecular Formula | C25H24N2O4SSe |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | methyl N-[(1R)-2-[1-(4-methylphenyl)sulfonylindol-3-yl]-1-phenylselanylethyl]carbamate |
| SMILES | COC(=O)N[C@@H](Cc1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12)[Se]c1ccccc1 |
| InChI | InChI=1S/C25H24N2O4SSe/c1-18-12-14-20(15-13-18)32(29,30)27-17-19(22-10-6-7-11-23(22)27)16-24(26-25(28)31-2)33-21-8-4-3-5-9-21/h3-15,17,24H,16H2,1-2H3,(H,26,28)/t24-/m1/s1 |
| InChIKey | RNKUDLXIVARLDR-XMMPIXPASA-N |
| XLogP | 3.44 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|