C22H26N2O5S — CID 71490277
tert-butyl N-[(1R)-2-hydroxy-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate (PubChem CID 71490277) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-hydroxy-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-hydroxy-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 71490277 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | tert-butyl N-[(1R)-2-hydroxy-1-[1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc([C@H](CO)NC(=O)OC(C)(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-15-9-11-16(12-10-15)30(27,28)24-13-18(17-7-5-6-8-20(17)24)19(14-25)23-21(26)29-22(2,3)4/h5-13,19,25H,14H2,1-4H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | MFKKGTSZVBWOTG-IBGZPJMESA-N |
| XLogP | 3.74 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |