C23H28N2O3S2 — CID 54589785
(R)-2-methyl-N-[(1S)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]but-3-enyl]propane-2-sulfinamide (PubChem CID 54589785) has the molecular formula C23H28N2O3S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is (R)-2-methyl-N-[(1S)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]but-3-enyl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(1S)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]but-3-enyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 54589785 |
| Molecular Formula | C23H28N2O3S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (R)-2-methyl-N-[(1S)-1-[1-(4-methylphenyl)sulfonylindol-3-yl]but-3-enyl]propane-2-sulfinamide |
| SMILES | C=CC[C@H](N[S@](=O)C(C)(C)C)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H28N2O3S2/c1-6-9-21(24-29(26)23(3,4)5)20-16-25(22-11-8-7-10-19(20)22)30(27,28)18-14-12-17(2)13-15-18/h6-8,10-16,21,24H,1,9H2,2-5H3/t21-,29+/m0/s1 |
| InChIKey | BKTBLMVSKUIUQN-KCWXNJEJSA-N |
| XLogP | 4.86 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|