C30H29NO4S — CID 56602426
ethyl (2Z)-2-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylethylidene]pent-4-enoate (PubChem CID 56602426) has the molecular formula C30H29NO4S and a molecular weight of 499.63 g/mol. Its IUPAC name is ethyl (2Z)-2-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylethylidene]pent-4-enoate.
| Compound Name | ethyl (2Z)-2-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylethylidene]pent-4-enoate |
|---|---|
| PubChem CID | 56602426 |
| Molecular Formula | C30H29NO4S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | ethyl (2Z)-2-[2-[1-(4-methylphenyl)sulfonylindol-3-yl]-2-phenylethylidene]pent-4-enoate |
| SMILES | C=CC/C(=C/C(c1ccccc1)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C30H29NO4S/c1-4-11-24(30(32)35-5-2)20-27(23-12-7-6-8-13-23)28-21-31(29-15-10-9-14-26(28)29)36(33,34)25-18-16-22(3)17-19-25/h4,6-10,12-21,27H,1,5,11H2,2-3H3/b24-20- |
| InChIKey | PKTIHDIIUOHZKU-GFMRDNFCSA-N |
| XLogP | 6.38 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|