C33H28N2O3S — CID 101448617
1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-3-(1-phenylprop-2-enyl)indol-2-one (PubChem CID 101448617) has the molecular formula C33H28N2O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is 1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-3-(1-phenylprop-2-enyl)indol-2-one.
| Compound Name | 1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-3-(1-phenylprop-2-enyl)indol-2-one |
|---|---|
| PubChem CID | 101448617 |
| Molecular Formula | C33H28N2O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 1-methyl-3-[1-(4-methylphenyl)sulfonylindol-3-yl]-3-(1-phenylprop-2-enyl)indol-2-one |
| SMILES | C=CC(c1ccccc1)C1(c2cn(S(=O)(=O)c3ccc(C)cc3)c3ccccc23)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C33H28N2O3S/c1-4-27(24-12-6-5-7-13-24)33(28-15-9-11-17-31(28)34(3)32(33)36)29-22-35(30-16-10-8-14-26(29)30)39(37,38)25-20-18-23(2)19-21-25/h4-22,27H,1H2,2-3H3 |
| InChIKey | CQMDMERNDUMRAJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|