C26H26N2O2S — CID 138973173
(8bR)-3-(4-methylphenyl)sulfonyl-8b-[(1S)-1-phenylprop-2-enyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole (PubChem CID 138973173) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is (8bR)-3-(4-methylphenyl)sulfonyl-8b-[(1S)-1-phenylprop-2-enyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole.
| Compound Name | (8bR)-3-(4-methylphenyl)sulfonyl-8b-[(1S)-1-phenylprop-2-enyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 138973173 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (8bR)-3-(4-methylphenyl)sulfonyl-8b-[(1S)-1-phenylprop-2-enyl]-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole |
| SMILES | C=C[C@@H](c1ccccc1)[C@@]12CCN(S(=O)(=O)c3ccc(C)cc3)C1Nc1ccccc12 |
| InChI | InChI=1S/C26H26N2O2S/c1-3-22(20-9-5-4-6-10-20)26-17-18-28(25(26)27-24-12-8-7-11-23(24)26)31(29,30)21-15-13-19(2)14-16-21/h3-16,22,25,27H,1,17-18H2,2H3/t22-,25?,26+/m0/s1 |
| InChIKey | WLAKOZMRBMJNBQ-QLFWGZPUSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|