C18H25NO2S — CID 102456735
(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2-prop-2-enylpyrrolidine (PubChem CID 102456735) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is (2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2-prop-2-enylpyrrolidine.
| Compound Name | (2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2-prop-2-enylpyrrolidine |
|---|---|
| PubChem CID | 102456735 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2R,3S)-3-methyl-1-(4-methylphenyl)sulfonyl-3-prop-1-en-2-yl-2-prop-2-enylpyrrolidine |
| SMILES | C=CC[C@H]1N(S(=O)(=O)c2ccc(C)cc2)CC[C@@]1(C)C(=C)C |
| InChI | InChI=1S/C18H25NO2S/c1-6-7-17-18(5,14(2)3)12-13-19(17)22(20,21)16-10-8-15(4)9-11-16/h6,8-11,17H,1-2,7,12-13H2,3-5H3/t17-,18+/m1/s1 |
| InChIKey | KAUGWQTVAMEIRT-MSOLQXFVSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|