C24H38N2O3S — CID 54763240
2,2,6,6-tetramethyl-1-[[(2S,4S)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-2-yl]methoxy]piperidine (PubChem CID 54763240) has the molecular formula C24H38N2O3S and a molecular weight of 434.65 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[[(2S,4S)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-2-yl]methoxy]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[[(2S,4S)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-2-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 54763240 |
| Molecular Formula | C24H38N2O3S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[[(2S,4S)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylpyrrolidin-2-yl]methoxy]piperidine |
| SMILES | C=CC[C@H]1C[C@@H](CON2C(C)(C)CCCC2(C)C)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H38N2O3S/c1-7-9-20-16-21(18-29-26-23(3,4)14-8-15-24(26,5)6)25(17-20)30(27,28)22-12-10-19(2)11-13-22/h7,10-13,20-21H,1,8-9,14-18H2,2-6H3/t20-,21-/m0/s1 |
| InChIKey | MXSLIRHOLBBLPZ-SFTDATJTSA-N |
| XLogP | 4.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|