C27H28N2O4S — CID 134112761
9,10-dimethoxy-4-(4-methylphenyl)sulfonyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene (PubChem CID 134112761) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 9,10-dimethoxy-4-(4-methylphenyl)sulfonyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene.
| Compound Name | 9,10-dimethoxy-4-(4-methylphenyl)sulfonyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene |
|---|---|
| PubChem CID | 134112761 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 9,10-dimethoxy-4-(4-methylphenyl)sulfonyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene |
| SMILES | COc1cc2c(cc1OC)C1Nc3ccccc3C13CCN(S(=O)(=O)c1ccc(C)cc1)C3C2 |
| InChI | InChI=1S/C27H28N2O4S/c1-17-8-10-19(11-9-17)34(30,31)29-13-12-27-21-6-4-5-7-22(21)28-26(27)20-16-24(33-3)23(32-2)14-18(20)15-25(27)29/h4-11,14,16,25-26,28H,12-13,15H2,1-3H3 |
| InChIKey | OTEOVZJUJAVANP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |