C19H23NO4S — CID 51856148
(2R)-1-(3,4-dimethoxyphenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine (PubChem CID 51856148) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is (2R)-1-(3,4-dimethoxyphenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine.
| Compound Name | (2R)-1-(3,4-dimethoxyphenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 51856148 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2R)-1-(3,4-dimethoxyphenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H]2c2ccccc2C)cc1OC |
| InChI | InChI=1S/C19H23NO4S/c1-14-7-4-5-8-16(14)17-9-6-12-20(17)25(21,22)15-10-11-18(23-2)19(13-15)24-3/h4-5,7-8,10-11,13,17H,6,9,12H2,1-3H3/t17-/m1/s1 |
| InChIKey | VHPGCTMCRMUCJH-QGZVFWFLSA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |