C17H18FNO2S — CID 51855972
(2S)-1-(4-fluorophenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine (PubChem CID 51855972) has the molecular formula C17H18FNO2S and a molecular weight of 319.40 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine.
| Compound Name | (2S)-1-(4-fluorophenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 51855972 |
| Molecular Formula | C17H18FNO2S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)sulfonyl-2-(2-methylphenyl)pyrrolidine |
| SMILES | Cc1ccccc1[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO2S/c1-13-5-2-3-6-16(13)17-7-4-12-19(17)22(20,21)15-10-8-14(18)9-11-15/h2-3,5-6,8-11,17H,4,7,12H2,1H3/t17-/m0/s1 |
| InChIKey | PTQGPPPBIWJVHU-KRWDZBQOSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |