C14H15FN2O2S — CID 47176211
2-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole (PubChem CID 47176211) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole.
| Compound Name | 2-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole |
|---|---|
| PubChem CID | 47176211 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCCC1c1ccc[nH]1 |
| InChI | InChI=1S/C14H15FN2O2S/c15-11-5-7-12(8-6-11)20(18,19)17-10-2-4-14(17)13-3-1-9-16-13/h1,3,5-9,14,16H,2,4,10H2 |
| InChIKey | LRPQDAUSQLSDNG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |