C14H14Br2N2O2S — CID 61073788
2-[1-(2,4-dibromophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole (PubChem CID 61073788) has the molecular formula C14H14Br2N2O2S and a molecular weight of 434.15 g/mol. Its IUPAC name is 2-[1-(2,4-dibromophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole.
| Compound Name | 2-[1-(2,4-dibromophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole |
|---|---|
| PubChem CID | 61073788 |
| Molecular Formula | C14H14Br2N2O2S |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | 2-[1-(2,4-dibromophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole |
| SMILES | O=S(=O)(c1ccc(Br)cc1Br)N1CCCC1c1ccc[nH]1 |
| InChI | InChI=1S/C14H14Br2N2O2S/c15-10-5-6-14(11(16)9-10)21(19,20)18-8-2-4-13(18)12-3-1-7-17-12/h1,3,5-7,9,13,17H,2,4,8H2 |
| InChIKey | FRNNKBAVHFWJER-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |