C22H24BrN5O4S — CID 10984316
tert-butyl N-[(2S)-2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate (PubChem CID 10984316) has the molecular formula C22H24BrN5O4S and a molecular weight of 534.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10984316 |
| Molecular Formula | C22H24BrN5O4S |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | tert-butyl N-[(2S)-2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc([C@@H](CNC(=O)OC(C)(C)C)N=[N+]=[N-])c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C22H24BrN5O4S/c1-14-5-8-16(9-6-14)33(30,31)28-13-18(17-10-7-15(23)11-20(17)28)19(26-27-24)12-25-21(29)32-22(2,3)4/h5-11,13,19H,12H2,1-4H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | HOSLLPQVOOLCRS-LJQANCHMSA-N |
| XLogP | 5.83 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|