C17H15BrN4O3S — CID 10884589
(1R)-2-azido-1-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanol (PubChem CID 10884589) has the molecular formula C17H15BrN4O3S and a molecular weight of 435.30 g/mol. Its IUPAC name is (1R)-2-azido-1-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanol.
| Compound Name | (1R)-2-azido-1-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanol |
|---|---|
| PubChem CID | 10884589 |
| Molecular Formula | C17H15BrN4O3S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | (1R)-2-azido-1-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanol |
| SMILES | Cc1ccc(S(=O)(=O)n2cc([C@@H](O)CN=[N+]=[N-])c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C17H15BrN4O3S/c1-11-2-5-13(6-3-11)26(24,25)22-10-15(17(23)9-20-21-19)14-7-4-12(18)8-16(14)22/h2-8,10,17,23H,9H2,1H3/t17-/m0/s1 |
| InChIKey | QFAWZBIASODOCW-KRWDZBQOSA-N |
| XLogP | 4.29 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|