C17H16BrN5O2S — CID 162405532
2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanamine (PubChem CID 162405532) has the molecular formula C17H16BrN5O2S and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanamine.
| Compound Name | 2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanamine |
|---|---|
| PubChem CID | 162405532 |
| Molecular Formula | C17H16BrN5O2S |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 2-azido-2-[6-bromo-1-(4-methylphenyl)sulfonylindol-3-yl]ethanamine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(CN)N=[N+]=[N-])c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C17H16BrN5O2S/c1-11-2-5-13(6-3-11)26(24,25)23-10-15(16(9-19)21-22-20)14-7-4-12(18)8-17(14)23/h2-8,10,16H,9,19H2,1H3 |
| InChIKey | BKOLEHPILWQODN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|