C28H20Br2N2O4S2 — CID 139048804
3,8-dibromo-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole (PubChem CID 139048804) has the molecular formula C28H20Br2N2O4S2 and a molecular weight of 672.42 g/mol. Its IUPAC name is 3,8-dibromo-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole.
| Compound Name | 3,8-dibromo-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole |
|---|---|
| PubChem CID | 139048804 |
| Molecular Formula | C28H20Br2N2O4S2 |
| Molecular Weight | 672.42 g/mol |
| Exact Mass | 669.92 |
| IUPAC Name | 3,8-dibromo-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccc(Br)cc3c3c2c2cc(Br)ccc2n3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H20Br2N2O4S2/c1-17-3-9-21(10-4-17)37(33,34)31-25-13-7-19(29)15-23(25)28-27(31)24-16-20(30)8-14-26(24)32(28)38(35,36)22-11-5-18(2)6-12-22/h3-16H,1-2H3 |
| InChIKey | PQIDTCGMFFINOD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.42 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |