C20H16ClNO2S — CID 102042180
6-chloro-1-methyl-9-(4-methylphenyl)sulfonylcarbazole (PubChem CID 102042180) has the molecular formula C20H16ClNO2S and a molecular weight of 369.87 g/mol. Its IUPAC name is 6-chloro-1-methyl-9-(4-methylphenyl)sulfonylcarbazole.
| Compound Name | 6-chloro-1-methyl-9-(4-methylphenyl)sulfonylcarbazole |
|---|---|
| PubChem CID | 102042180 |
| Molecular Formula | C20H16ClNO2S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 6-chloro-1-methyl-9-(4-methylphenyl)sulfonylcarbazole |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccc(Cl)cc3c3cccc(C)c32)cc1 |
| InChI | InChI=1S/C20H16ClNO2S/c1-13-6-9-16(10-7-13)25(23,24)22-19-11-8-15(21)12-18(19)17-5-3-4-14(2)20(17)22/h3-12H,1-2H3 |
| InChIKey | UEEVECQXNWYEJF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |