C18H18ClNO3S — CID 173212087
6-chloro-3-ethoxy-2-methyl-1-(4-methylphenyl)sulfonylindole (PubChem CID 173212087) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is 6-chloro-3-ethoxy-2-methyl-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 6-chloro-3-ethoxy-2-methyl-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 173212087 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 6-chloro-3-ethoxy-2-methyl-1-(4-methylphenyl)sulfonylindole |
| SMILES | CCOc1c(C)n(S(=O)(=O)c2ccc(C)cc2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H18ClNO3S/c1-4-23-18-13(3)20(17-11-14(19)7-10-16(17)18)24(21,22)15-8-5-12(2)6-9-15/h5-11H,4H2,1-3H3 |
| InChIKey | ZOKYLPUYMZIVKK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |