C24H31ClN2O6S — CID 3060295
ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 3060295) has the molecular formula C24H31ClN2O6S and a molecular weight of 511.04 g/mol. Its IUPAC name is ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 3060295 |
| Molecular Formula | C24H31ClN2O6S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)c1c(OCC)c2ccc(Cl)cc2n1CCN(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H23ClN2O3.C7H8O3S/c1-5-22-16-13-8-7-12(18)11-14(13)20(10-9-19(3)4)15(16)17(21)23-6-2;1-6-2-4-7(5-3-6)11(8,9)10/h7-8,11H,5-6,9-10H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | SMEUIVMAOMZIKD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|