About ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid
ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 3060295) has the molecular formula C24H31ClN2O6S
and a molecular weight of 511.04 g/mol. Its IUPAC name is ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid |
| PubChem CID | 3060295 |
| Molecular Formula | C24H31ClN2O6S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)c1c(OCC)c2ccc(Cl)cc2n1CCN(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H23ClN2O3.C7H8O3S/c1-5-22-16-13-8-7-12(18)11-14(13)20(10-9-19(3)4)15(16)17(21)23-6-2;1-6-2-4-7(5-3-6)11(8,9)10/h7-8,11H,5-6,9-10H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | SMEUIVMAOMZIKD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid?
The IUPAC name of ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid (CID 3060295) is ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid.
What is the SMILES notation for ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid?
The canonical SMILES for ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid is CCOC(=O)c1c(OCC)c2ccc(Cl)cc2n1CCN(C)C.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid?
The InChIKey is SMEUIVMAOMZIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN2O3.C7H8O3S/c1-5-22-16-13-8-7-12(18)11-14(13)20(10-9-19(3)4)15(16)17(21)23-6-2;1-6-2-4-7(5-3-6)11(8,9)10/h7-8,11H,5-6,9-10H2,1-4H3;2-5H,1H3,(H,8,9,10).
What are the key properties of ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid?
ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid has a molecular weight of 511.04 g/mol, XLogP of 4.67, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-chloro-1-[2-(dimethylamino)ethyl]-3-ethoxyindole-2-carboxylate;4-methylbenzenesulfonic acid is sourced from PubChem (CID 3060295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).