C26H25ClNO5PS — CID 143230555
ethyl 1-(benzenesulfonyl)-5-chloro-3-[ethoxy-(4-methylphenyl)phosphanyl]indole-2-carboxylate (PubChem CID 143230555) has the molecular formula C26H25ClNO5PS and a molecular weight of 529.98 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-5-chloro-3-[ethoxy-(4-methylphenyl)phosphanyl]indole-2-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-5-chloro-3-[ethoxy-(4-methylphenyl)phosphanyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 143230555 |
| Molecular Formula | C26H25ClNO5PS |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-5-chloro-3-[ethoxy-(4-methylphenyl)phosphanyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(P(OCC)c2ccc(C)cc2)c2cc(Cl)ccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25ClNO5PS/c1-4-32-26(29)24-25(34(33-5-2)20-14-11-18(3)12-15-20)22-17-19(27)13-16-23(22)28(24)35(30,31)21-9-7-6-8-10-21/h6-17H,4-5H2,1-3H3 |
| InChIKey | YPRXPCYSXSHSTJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|