C27H30Cl2NO5PS — CID 143230677
acetylene;ethyl 5-chloro-3-[(3-chlorophenyl)-ethoxyphosphanyl]-1-prop-2-enylsulfonylindole-2-carboxylate;prop-1-ene (PubChem CID 143230677) has the molecular formula C27H30Cl2NO5PS and a molecular weight of 582.49 g/mol. Its IUPAC name is acetylene;ethyl 5-chloro-3-[(3-chlorophenyl)-ethoxyphosphanyl]-1-prop-2-enylsulfonylindole-2-carboxylate;prop-1-ene.
| Compound Name | acetylene;ethyl 5-chloro-3-[(3-chlorophenyl)-ethoxyphosphanyl]-1-prop-2-enylsulfonylindole-2-carboxylate;prop-1-ene |
|---|---|
| PubChem CID | 143230677 |
| Molecular Formula | C27H30Cl2NO5PS |
| Molecular Weight | 582.49 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | acetylene;ethyl 5-chloro-3-[(3-chlorophenyl)-ethoxyphosphanyl]-1-prop-2-enylsulfonylindole-2-carboxylate;prop-1-ene |
| SMILES | C#C.C=CC.C=CCS(=O)(=O)n1c(C(=O)OCC)c(P(OCC)c2cccc(Cl)c2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H22Cl2NO5PS.C3H6.C2H2/c1-4-12-32(27,28)25-19-11-10-16(24)14-18(19)21(20(25)22(26)29-5-2)31(30-6-3)17-9-7-8-15(23)13-17;1-3-2;1-2/h4,7-11,13-14H,1,5-6,12H2,2-3H3;3H,1H2,2H3;1-2H |
| InChIKey | DZTZFWIOGIYYSY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|