C18H18ClN2O2P — CID 143230568
5-chloro-3-[(3-ethylphenyl)-methoxyphosphanyl]-1H-indole-2-carboxamide (PubChem CID 143230568) has the molecular formula C18H18ClN2O2P and a molecular weight of 360.78 g/mol. Its IUPAC name is 5-chloro-3-[(3-ethylphenyl)-methoxyphosphanyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[(3-ethylphenyl)-methoxyphosphanyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143230568 |
| Molecular Formula | C18H18ClN2O2P |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5-chloro-3-[(3-ethylphenyl)-methoxyphosphanyl]-1H-indole-2-carboxamide |
| SMILES | CCc1cccc(P(OC)c2c(C(N)=O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C18H18ClN2O2P/c1-3-11-5-4-6-13(9-11)24(23-2)17-14-10-12(19)7-8-15(14)21-16(17)18(20)22/h4-10,21H,3H2,1-2H3,(H2,20,22) |
| InChIKey | IQBRRHOOADHSKH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|